About pentyl 2-phosphanylacetate
pentyl 2-phosphanylacetate (PubChem CID 87942659) has the molecular formula C7H15O2P
and a molecular weight of 162.17 g/mol. Its IUPAC name is pentyl 2-phosphanylacetate.
Molecular Properties
| Compound Name | pentyl 2-phosphanylacetate |
| PubChem CID | 87942659 |
| Molecular Formula | C7H15O2P |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | pentyl 2-phosphanylacetate |
| SMILES | CCCCCOC(=O)CP |
| InChI | InChI=1S/C7H15O2P/c1-2-3-4-5-9-7(8)6-10/h2-6,10H2,1H3 |
| InChIKey | XEDLZBWEVBNKGC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentyl 2-phosphanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 2-phosphanylacetate?
The IUPAC name of pentyl 2-phosphanylacetate (CID 87942659) is pentyl 2-phosphanylacetate.
What is the SMILES notation for pentyl 2-phosphanylacetate?
The canonical SMILES for pentyl 2-phosphanylacetate is CCCCCOC(=O)CP.
What is the InChIKey of pentyl 2-phosphanylacetate?
The InChIKey is XEDLZBWEVBNKGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O2P/c1-2-3-4-5-9-7(8)6-10/h2-6,10H2,1H3.
What are the key properties of pentyl 2-phosphanylacetate?
pentyl 2-phosphanylacetate has a molecular weight of 162.17 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 2-phosphanylacetate is sourced from PubChem (CID 87942659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).