C11H20F3NO — CID 87943140
N,N-diethyl-4-(trifluoromethyl)hexanamide (PubChem CID 87943140) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is N,N-diethyl-4-(trifluoromethyl)hexanamide.
| Compound Name | N,N-diethyl-4-(trifluoromethyl)hexanamide |
|---|---|
| PubChem CID | 87943140 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N,N-diethyl-4-(trifluoromethyl)hexanamide |
| SMILES | CCC(CCC(=O)N(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-4-9(11(12,13)14)7-8-10(16)15(5-2)6-3/h9H,4-8H2,1-3H3 |
| InChIKey | FUIGMZFBNDLCLZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |