C26H51NO8P+ — CID 87944746
2-[[(2S,12Z,15Z)-2-hydroperoxy-1-hydroxy-4-oxohenicosa-12,15-dien-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 87944746) has the molecular formula C26H51NO8P+ and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[[(2S,12Z,15Z)-2-hydroperoxy-1-hydroxy-4-oxohenicosa-12,15-dien-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2S,12Z,15Z)-2-hydroperoxy-1-hydroxy-4-oxohenicosa-12,15-dien-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87944746 |
| Molecular Formula | C26H51NO8P+ |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 2-[[(2S,12Z,15Z)-2-hydroperoxy-1-hydroxy-4-oxohenicosa-12,15-dien-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C(OP(=O)(O)OCC[N+](C)(C)C)[C@H](CO)OO |
| InChI | InChI=1S/C26H50NO8P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(29)26(25(23-28)34-30)35-36(31,32)33-22-21-27(2,3)4/h9-10,12-13,25-26,28H,5-8,11,14-23H2,1-4H3,(H-,30,31,32)/p+1/b10-9-,13-12-/t25-,26?/m0/s1 |
| InChIKey | VFDIRXOEGAKERV-XAUYVEQLSA-O |
| XLogP | 5.43 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|