C19H36N2O4 — CID 87949067
(E)-3-(diethylamino)-2-methylpent-2-enoic acid;(E)-2-(diethylamino)pent-2-enoic acid (PubChem CID 87949067) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is (E)-3-(diethylamino)-2-methylpent-2-enoic acid;(E)-2-(diethylamino)pent-2-enoic acid.
| Compound Name | (E)-3-(diethylamino)-2-methylpent-2-enoic acid;(E)-2-(diethylamino)pent-2-enoic acid |
|---|---|
| PubChem CID | 87949067 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (E)-3-(diethylamino)-2-methylpent-2-enoic acid;(E)-2-(diethylamino)pent-2-enoic acid |
| SMILES | CC/C(=C(/C)C(=O)O)N(CC)CC.CC/C=C(\C(=O)O)N(CC)CC |
| InChI | InChI=1S/C10H19NO2.C9H17NO2/c1-5-9(8(4)10(12)13)11(6-2)7-3;1-4-7-8(9(11)12)10(5-2)6-3/h5-7H2,1-4H3,(H,12,13);7H,4-6H2,1-3H3,(H,11,12)/b9-8+;8-7+ |
| InChIKey | CWEKGDXBTGQMRP-ITFLXOGHSA-N |
| XLogP | 3.80 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|