C13H17AsN2 — CID 87950120
CID 87950120 (PubChem CID 87950120) has the molecular formula C13H17AsN2 and a molecular weight of 276.21 g/mol.
| Compound Name | CID 87950120 |
|---|---|
| PubChem CID | 87950120 |
| Molecular Formula | C13H17AsN2 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | — |
| SMILES | [As]C1C2CCN(CC2)C1Cc1cccnc1 |
| InChI | InChI=1S/C13H17AsN2/c14-13-11-3-6-16(7-4-11)12(13)8-10-2-1-5-15-9-10/h1-2,5,9,11-13H,3-4,6-8H2 |
| InChIKey | HBEZKUWOOCVYCY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|