C20H15F3N4O4S — CID 87952638
1-[(8-aminoquinolin-4-yl)methyl]-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)imidazolidine-2,4-dione (PubChem CID 87952638) has the molecular formula C20H15F3N4O4S and a molecular weight of 464.43 g/mol. Its IUPAC name is 1-[(8-aminoquinolin-4-yl)methyl]-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)imidazolidine-2,4-dione.
| Compound Name | 1-[(8-aminoquinolin-4-yl)methyl]-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87952638 |
| Molecular Formula | C20H15F3N4O4S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 1-[(8-aminoquinolin-4-yl)methyl]-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)c1c(F)cc(N2C(=O)CN(Cc3ccnc4c(N)cccc34)C2=O)c(F)c1F |
| InChI | InChI=1S/C20H15F3N4O4S/c1-32(30,31)19-12(21)7-14(16(22)17(19)23)27-15(28)9-26(20(27)29)8-10-5-6-25-18-11(10)3-2-4-13(18)24/h2-7H,8-9,24H2,1H3 |
| InChIKey | YEPHEFMPFAHWAP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|