C22H21F3N4O2S — CID 141097407
4-[[6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]methyl]quinolin-8-amine (PubChem CID 141097407) has the molecular formula C22H21F3N4O2S and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-[[6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]methyl]quinolin-8-amine.
| Compound Name | 4-[[6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]methyl]quinolin-8-amine |
|---|---|
| PubChem CID | 141097407 |
| Molecular Formula | C22H21F3N4O2S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 4-[[6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptan-4-yl]methyl]quinolin-8-amine |
| SMILES | Nc1cccc2c(CN3CN(c4ccc(S(=O)(=O)C(F)(F)F)cc4)CC34CC4)ccnc12 |
| InChI | InChI=1S/C22H21F3N4O2S/c23-22(24,25)32(30,31)17-6-4-16(5-7-17)28-13-21(9-10-21)29(14-28)12-15-8-11-27-20-18(15)2-1-3-19(20)26/h1-8,11H,9-10,12-14,26H2 |
| InChIKey | BFUJULUGRAWTDI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|