C21H16F3N3O3S2 — CID 118916769
(5S)-5-methyl-1-(quinolin-4-ylmethyl)-4-sulfanylidene-5-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-2-one (PubChem CID 118916769) has the molecular formula C21H16F3N3O3S2 and a molecular weight of 479.51 g/mol. Its IUPAC name is (5S)-5-methyl-1-(quinolin-4-ylmethyl)-4-sulfanylidene-5-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-2-one.
| Compound Name | (5S)-5-methyl-1-(quinolin-4-ylmethyl)-4-sulfanylidene-5-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 118916769 |
| Molecular Formula | C21H16F3N3O3S2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | (5S)-5-methyl-1-(quinolin-4-ylmethyl)-4-sulfanylidene-5-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-2-one |
| SMILES | C[C@]1(c2ccc(S(=O)(=O)C(F)(F)F)cc2)C(=S)NC(=O)N1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C21H16F3N3O3S2/c1-20(14-6-8-15(9-7-14)32(29,30)21(22,23)24)18(31)26-19(28)27(20)12-13-10-11-25-17-5-3-2-4-16(13)17/h2-11H,12H2,1H3,(H,26,28,31)/t20-/m0/s1 |
| InChIKey | GQKHBBFFYBAKEV-FQEVSTJZSA-N |
| XLogP | 4.30 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|