C13H23N5O2S — CID 87952995
1-acetyl-N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]piperidin-4-amine oxide (PubChem CID 87952995) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 1-acetyl-N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]piperidin-4-amine oxide.
| Compound Name | 1-acetyl-N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]piperidin-4-amine oxide |
|---|---|
| PubChem CID | 87952995 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-acetyl-N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]piperidin-4-amine oxide |
| SMILES | CC(=O)N1CCC([NH+]([O-])NCCN2CSCC2C#N)CC1 |
| InChI | InChI=1S/C13H23N5O2S/c1-11(19)16-5-2-12(3-6-16)18(20)15-4-7-17-10-21-9-13(17)8-14/h12-13,15,18H,2-7,9-10H2,1H3 |
| InChIKey | JGFDWKKTEZZTSK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|