C15H22N4O3S — CID 87953242
ethyl 2-[2-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 87953242) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is ethyl 2-[2-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 87953242 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | ethyl 2-[2-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(CC(C)C)C(=O)N(C)C#N)n1 |
| InChI | InChI=1S/C15H22N4O3S/c1-5-22-13(20)7-11-8-23-15(17-11)18-12(6-10(2)3)14(21)19(4)9-16/h8,10,12H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | KYVHHRBNVCFKMO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|