C25H29N3O6S — CID 87953744
[4-[(3R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 87953744) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is [4-[(3R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(3R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87953744 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | [4-[(3R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(OS(=O)(=O)c2ccc(C)cc2)cc(OC)c1[C@@H]1CN[C@H](C(=O)N2CCC[C@H]2C#N)C1 |
| InChI | InChI=1S/C25H29N3O6S/c1-16-6-8-20(9-7-16)35(30,31)34-19-12-22(32-2)24(23(13-19)33-3)17-11-21(27-15-17)25(29)28-10-4-5-18(28)14-26/h6-9,12-13,17-18,21,27H,4-5,10-11,15H2,1-3H3/t17-,18-,21-/m0/s1 |
| InChIKey | JRNBONNKUQZYKY-WFXMLNOXSA-N |
| XLogP | 2.74 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|