C23H25F2N3O4S — CID 87953836
(2S)-1-[(2S,4R)-4-(2,6-difluorophenyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonitrile;4-methylbenzenesulfonic acid (PubChem CID 87953836) has the molecular formula C23H25F2N3O4S and a molecular weight of 477.53 g/mol. Its IUPAC name is (2S)-1-[(2S,4R)-4-(2,6-difluorophenyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonitrile;4-methylbenzenesulfonic acid.
| Compound Name | (2S)-1-[(2S,4R)-4-(2,6-difluorophenyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonitrile;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87953836 |
| Molecular Formula | C23H25F2N3O4S |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (2S)-1-[(2S,4R)-4-(2,6-difluorophenyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonitrile;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N#C[C@@H]1CCCN1C(=O)[C@@H]1C[C@H](c2c(F)cccc2F)CN1 |
| InChI | InChI=1S/C16H17F2N3O.C7H8O3S/c17-12-4-1-5-13(18)15(12)10-7-14(20-9-10)16(22)21-6-2-3-11(21)8-19;1-6-2-4-7(5-3-6)11(8,9)10/h1,4-5,10-11,14,20H,2-3,6-7,9H2;2-5H,1H3,(H,8,9,10)/t10-,11-,14-;/m0./s1 |
| InChIKey | OLPBWLQRFTZMCT-UWSFXBGYSA-N |
| XLogP | 3.17 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|