C17H20O4 — CID 87954267
(1-ethoxy-1-oxopropan-2-yl) 2-(2-methylphenyl)pent-4-ynoate (PubChem CID 87954267) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 2-(2-methylphenyl)pent-4-ynoate.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 2-(2-methylphenyl)pent-4-ynoate |
|---|---|
| PubChem CID | 87954267 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 2-(2-methylphenyl)pent-4-ynoate |
| SMILES | C#CCC(C(=O)OC(C)C(=O)OCC)c1ccccc1C |
| InChI | InChI=1S/C17H20O4/c1-5-9-15(14-11-8-7-10-12(14)3)17(19)21-13(4)16(18)20-6-2/h1,7-8,10-11,13,15H,6,9H2,2-4H3 |
| InChIKey | GFYAYLHXMDRWCE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|