C23H19ClFN5O3 — CID 87955479
[1-[6-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]piperidin-4-yl]carbamic acid (PubChem CID 87955479) has the molecular formula C23H19ClFN5O3 and a molecular weight of 467.89 g/mol. Its IUPAC name is [1-[6-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[6-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 87955479 |
| Molecular Formula | C23H19ClFN5O3 |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [1-[6-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2ncnc3oc(-c4ccc(Cl)nc4)c(-c4ccc(F)cc4)c23)CC1 |
| InChI | InChI=1S/C23H19ClFN5O3/c24-17-6-3-14(11-26-17)20-18(13-1-4-15(25)5-2-13)19-21(27-12-28-22(19)33-20)30-9-7-16(8-10-30)29-23(31)32/h1-6,11-12,16,29H,7-10H2,(H,31,32) |
| InChIKey | URMAHDPVSCYXQQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|