C14H26N2O3S2 — CID 87955796
tert-butyl N-[2,2,5-trimethyl-4-oxo-1,5-bis(sulfanyl)azepan-3-yl]carbamate (PubChem CID 87955796) has the molecular formula C14H26N2O3S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is tert-butyl N-[2,2,5-trimethyl-4-oxo-1,5-bis(sulfanyl)azepan-3-yl]carbamate.
| Compound Name | tert-butyl N-[2,2,5-trimethyl-4-oxo-1,5-bis(sulfanyl)azepan-3-yl]carbamate |
|---|---|
| PubChem CID | 87955796 |
| Molecular Formula | C14H26N2O3S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | tert-butyl N-[2,2,5-trimethyl-4-oxo-1,5-bis(sulfanyl)azepan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C(=O)C(C)(S)CCN(S)C1(C)C |
| InChI | InChI=1S/C14H26N2O3S2/c1-12(2,3)19-11(18)15-9-10(17)14(6,20)7-8-16(21)13(9,4)5/h9,20-21H,7-8H2,1-6H3,(H,15,18) |
| InChIKey | FZCNXGOYWQKMIS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|