C22H14F6N2O4 — CID 87957096
(2,3,4,5,6-pentafluorophenyl) 2-[4-(N-carbamoyl-2-fluoroanilino)-3-methoxyphenyl]acetate (PubChem CID 87957096) has the molecular formula C22H14F6N2O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[4-(N-carbamoyl-2-fluoroanilino)-3-methoxyphenyl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[4-(N-carbamoyl-2-fluoroanilino)-3-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 87957096 |
| Molecular Formula | C22H14F6N2O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[4-(N-carbamoyl-2-fluoroanilino)-3-methoxyphenyl]acetate |
| SMILES | COc1cc(CC(=O)Oc2c(F)c(F)c(F)c(F)c2F)ccc1N(C(N)=O)c1ccccc1F |
| InChI | InChI=1S/C22H14F6N2O4/c1-33-14-8-10(6-7-13(14)30(22(29)32)12-5-3-2-4-11(12)23)9-15(31)34-21-19(27)17(25)16(24)18(26)20(21)28/h2-8H,9H2,1H3,(H2,29,32) |
| InChIKey | NXSZCKBXOXQYJY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|