C19H41N5O2 — CID 87957327
N-[3-(4-aminobutylamino)propyl]-2-(2-decanoylhydrazinyl)acetamide (PubChem CID 87957327) has the molecular formula C19H41N5O2 and a molecular weight of 371.57 g/mol. Its IUPAC name is N-[3-(4-aminobutylamino)propyl]-2-(2-decanoylhydrazinyl)acetamide.
| Compound Name | N-[3-(4-aminobutylamino)propyl]-2-(2-decanoylhydrazinyl)acetamide |
|---|---|
| PubChem CID | 87957327 |
| Molecular Formula | C19H41N5O2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | N-[3-(4-aminobutylamino)propyl]-2-(2-decanoylhydrazinyl)acetamide |
| SMILES | CCCCCCCCCC(=O)NNCC(=O)NCCCNCCCCN |
| InChI | InChI=1S/C19H41N5O2/c1-2-3-4-5-6-7-8-12-18(25)24-23-17-19(26)22-16-11-15-21-14-10-9-13-20/h21,23H,2-17,20H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | QEFFVQAONJTZQC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|