About acetyl(pentyl)carbamic acid
acetyl(pentyl)carbamic acid (PubChem CID 87957714) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is acetyl(pentyl)carbamic acid.
Molecular Properties
| Compound Name | acetyl(pentyl)carbamic acid |
| PubChem CID | 87957714 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | acetyl(pentyl)carbamic acid |
| SMILES | CCCCCN(C(C)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-3-4-5-6-9(7(2)10)8(11)12/h3-6H2,1-2H3,(H,11,12) |
| InChIKey | HZAUWZOSEKPSAL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetyl(pentyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl(pentyl)carbamic acid?
The IUPAC name of acetyl(pentyl)carbamic acid (CID 87957714) is acetyl(pentyl)carbamic acid.
What is the SMILES notation for acetyl(pentyl)carbamic acid?
The canonical SMILES for acetyl(pentyl)carbamic acid is CCCCCN(C(C)=O)C(=O)O.
What is the InChIKey of acetyl(pentyl)carbamic acid?
The InChIKey is HZAUWZOSEKPSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-3-4-5-6-9(7(2)10)8(11)12/h3-6H2,1-2H3,(H,11,12).
What are the key properties of acetyl(pentyl)carbamic acid?
acetyl(pentyl)carbamic acid has a molecular weight of 173.21 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(pentyl)carbamic acid is sourced from PubChem (CID 87957714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).