acetyl(pentyl)carbamic acid

C8H15NO3 — CID 87957714

IUPACacetyl(pentyl)carbamic acid
SMILESCCCCCN(C(C)=O)C(=O)O
InChIInChI=1S/C8H15NO3/c1-3-4-5-6-9(7(2)10)8(11)12/h3-6H2,1-2H3,(H,11,12)
InChIKeyHZAUWZOSEKPSAL-UHFFFAOYSA-N
MW173.21 g/mol
LogP1.70
Rot. Bonds4

About acetyl(pentyl)carbamic acid

acetyl(pentyl)carbamic acid (PubChem CID 87957714) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is acetyl(pentyl)carbamic acid.

Molecular Properties

Compound Nameacetyl(pentyl)carbamic acid
PubChem CID87957714
Molecular FormulaC8H15NO3
Molecular Weight173.21 g/mol
Exact Mass173.11
IUPAC Nameacetyl(pentyl)carbamic acid
SMILESCCCCCN(C(C)=O)C(=O)O
InChIInChI=1S/C8H15NO3/c1-3-4-5-6-9(7(2)10)8(11)12/h3-6H2,1-2H3,(H,11,12)
InChIKeyHZAUWZOSEKPSAL-UHFFFAOYSA-N
XLogP1.70
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.21
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze acetyl(pentyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetyl(pentyl)carbamic acid?
The IUPAC name of acetyl(pentyl)carbamic acid (CID 87957714) is acetyl(pentyl)carbamic acid.
What is the SMILES notation for acetyl(pentyl)carbamic acid?
The canonical SMILES for acetyl(pentyl)carbamic acid is CCCCCN(C(C)=O)C(=O)O.
What is the InChIKey of acetyl(pentyl)carbamic acid?
The InChIKey is HZAUWZOSEKPSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-3-4-5-6-9(7(2)10)8(11)12/h3-6H2,1-2H3,(H,11,12).
What are the key properties of acetyl(pentyl)carbamic acid?
acetyl(pentyl)carbamic acid has a molecular weight of 173.21 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(pentyl)carbamic acid is sourced from PubChem (CID 87957714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).