C19H14Cl2FN3O2 — CID 87958107
4-(2-chloro-5-fluoropyrimidin-4-yl)-N-[2-(3-chlorophenyl)-2-hydroxyethyl]benzamide (PubChem CID 87958107) has the molecular formula C19H14Cl2FN3O2 and a molecular weight of 406.24 g/mol. Its IUPAC name is 4-(2-chloro-5-fluoropyrimidin-4-yl)-N-[2-(3-chlorophenyl)-2-hydroxyethyl]benzamide.
| Compound Name | 4-(2-chloro-5-fluoropyrimidin-4-yl)-N-[2-(3-chlorophenyl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 87958107 |
| Molecular Formula | C19H14Cl2FN3O2 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-(2-chloro-5-fluoropyrimidin-4-yl)-N-[2-(3-chlorophenyl)-2-hydroxyethyl]benzamide |
| SMILES | O=C(NCC(O)c1cccc(Cl)c1)c1ccc(-c2nc(Cl)ncc2F)cc1 |
| InChI | InChI=1S/C19H14Cl2FN3O2/c20-14-3-1-2-13(8-14)16(26)10-23-18(27)12-6-4-11(5-7-12)17-15(22)9-24-19(21)25-17/h1-9,16,26H,10H2,(H,23,27) |
| InChIKey | WVWMYQKREABDRP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |