C9H10N2O3S — CID 87958788
3-[carbamoyl(sulfanyl)amino]-4-methylbenzoic acid (PubChem CID 87958788) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 3-[carbamoyl(sulfanyl)amino]-4-methylbenzoic acid.
| Compound Name | 3-[carbamoyl(sulfanyl)amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 87958788 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3-[carbamoyl(sulfanyl)amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1N(S)C(N)=O |
| InChI | InChI=1S/C9H10N2O3S/c1-5-2-3-6(8(12)13)4-7(5)11(15)9(10)14/h2-4,15H,1H3,(H2,10,14)(H,12,13) |
| InChIKey | ZCMFFHIGKBLTRW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|