C15H24Cl2N2O2 — CID 3053406
3-[bis(2-chloroethyl)amino]-4-methylbenzoic acid;propan-2-amine (PubChem CID 3053406) has the molecular formula C15H24Cl2N2O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 3-[bis(2-chloroethyl)amino]-4-methylbenzoic acid;propan-2-amine.
| Compound Name | 3-[bis(2-chloroethyl)amino]-4-methylbenzoic acid;propan-2-amine |
|---|---|
| PubChem CID | 3053406 |
| Molecular Formula | C15H24Cl2N2O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-[bis(2-chloroethyl)amino]-4-methylbenzoic acid;propan-2-amine |
| SMILES | CC(C)N.Cc1ccc(C(=O)O)cc1N(CCCl)CCCl |
| InChI | InChI=1S/C12H15Cl2NO2.C3H9N/c1-9-2-3-10(12(16)17)8-11(9)15(6-4-13)7-5-14;1-3(2)4/h2-3,8H,4-7H2,1H3,(H,16,17);3H,4H2,1-2H3 |
| InChIKey | VLBHGZCPONDJSR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|