C45H68N2 — CID 87960106
1-[2-(1-diazohex-1-en-2-yl)-1-(4-hexylphenyl)dec-1-enyl]-2-undec-4-enylbenzene (PubChem CID 87960106) has the molecular formula C45H68N2 and a molecular weight of 637.05 g/mol. Its IUPAC name is 1-[2-(1-diazohex-1-en-2-yl)-1-(4-hexylphenyl)dec-1-enyl]-2-undec-4-enylbenzene.
| Compound Name | 1-[2-(1-diazohex-1-en-2-yl)-1-(4-hexylphenyl)dec-1-enyl]-2-undec-4-enylbenzene |
|---|---|
| PubChem CID | 87960106 |
| Molecular Formula | C45H68N2 |
| Molecular Weight | 637.05 g/mol |
| Exact Mass | 636.54 |
| IUPAC Name | 1-[2-(1-diazohex-1-en-2-yl)-1-(4-hexylphenyl)dec-1-enyl]-2-undec-4-enylbenzene |
| SMILES | CCCCCCC=CCCCc1ccccc1C(=C(CCCCCCCC)C(=C=[N+]=[N-])CCCC)c1ccc(CCCCCC)cc1 |
| InChI | InChI=1S/C45H68N2/c1-5-9-13-16-18-19-20-21-24-30-40-31-26-27-33-43(40)45(41-36-34-39(35-37-41)28-23-15-11-7-3)44(32-25-22-17-14-10-6-2)42(38-47-46)29-12-8-4/h19-20,26-27,31,33-37H,5-18,21-25,28-30,32H2,1-4H3 |
| InChIKey | XVNBZTFPBUXZPF-UHFFFAOYSA-N |
| XLogP | 14.23 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.05 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|