C52H69Cl3N2O12 — CID 87961329
2-chloro-2,3-bis[3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]butanedioic acid dichloride (PubChem CID 87961329) has the molecular formula C52H69Cl3N2O12 and a molecular weight of 1020.48 g/mol. Its IUPAC name is 2-chloro-2,3-bis[3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]butanedioic acid dichloride.
| Compound Name | 2-chloro-2,3-bis[3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]butanedioic acid dichloride |
|---|---|
| PubChem CID | 87961329 |
| Molecular Formula | C52H69Cl3N2O12 |
| Molecular Weight | 1020.48 g/mol |
| Exact Mass | 1018.39 |
| IUPAC Name | 2-chloro-2,3-bis[3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl]butanedioic acid dichloride |
| SMILES | COc1ccc(C[C@@H]2c3cc(OC)c(OC)cc3CC[N@@+]2(C)CCCC(C(=O)O)C(Cl)(CCC[N@+]2(C)CCc3cc(OC)c(OC)cc3[C@H]2Cc2ccc(OC)c(OC)c2)C(=O)O)cc1OC.[Cl-].[Cl-] |
| InChI | InChI=1S/C52H67ClN2O12.2ClH/c1-54(23-18-35-29-46(64-7)48(66-9)31-37(35)40(54)25-33-14-16-42(60-3)44(27-33)62-5)21-11-13-39(50(56)57)52(53,51(58)59)20-12-22-55(2)24-19-36-30-47(65-8)49(67-10)32-38(36)41(55)26-34-15-17-43(61-4)45(28-34)63-6;;/h14-17,27-32,39-41H,11-13,18-26H2,1-10H3;2*1H/t39?,40-,41-,52?,54-,55-;;/m1../s1 |
| InChIKey | ZSSJSOZXUIXLRB-WHRJUBDWSA-N |
| XLogP | 2.36 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 69 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|