About N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide
N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide (PubChem CID 87962232) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide |
| PubChem CID | 87962232 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide |
| SMILES | CC(C)=CCCC(C)CC(=O)NCCO |
| InChI | InChI=1S/C12H23NO2/c1-10(2)5-4-6-11(3)9-12(15)13-7-8-14/h5,11,14H,4,6-9H2,1-3H3,(H,13,15) |
| InChIKey | SOYAYIPYTAINDN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
The IUPAC name of N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide (CID 87962232) is N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide.
What is the SMILES notation for N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
The canonical SMILES for N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide is CC(C)=CCCC(C)CC(=O)NCCO.
What is the InChIKey of N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
The InChIKey is SOYAYIPYTAINDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-10(2)5-4-6-11(3)9-12(15)13-7-8-14/h5,11,14H,4,6-9H2,1-3H3,(H,13,15).
What are the key properties of N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide has a molecular weight of 213.32 g/mol, XLogP of 1.87, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-3,7-dimethyloct-6-enamide is sourced from PubChem (CID 87962232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).