C15H19N3O4 — CID 87962897
(2S)-1-[(4S)-1,4-diamino-1,3-dioxohexan-2-yl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 87962897) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (2S)-1-[(4S)-1,4-diamino-1,3-dioxohexan-2-yl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[(4S)-1,4-diamino-1,3-dioxohexan-2-yl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 87962897 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S)-1-[(4S)-1,4-diamino-1,3-dioxohexan-2-yl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC[C@H](N)C(=O)C(C(N)=O)N1c2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C15H19N3O4/c1-2-9(16)13(19)12(14(17)20)18-10-6-4-3-5-8(10)7-11(18)15(21)22/h3-6,9,11-12H,2,7,16H2,1H3,(H2,17,20)(H,21,22)/t9-,11-,12?/m0/s1 |
| InChIKey | JMIYDRSIEJCQQH-HFLPBZFISA-N |
| XLogP | -0.34 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|