C17H34O4 — CID 87962949
4,4-bis[(2-methylpropan-2-yl)oxy]nonanoic acid (PubChem CID 87962949) has the molecular formula C17H34O4 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4,4-bis[(2-methylpropan-2-yl)oxy]nonanoic acid.
| Compound Name | 4,4-bis[(2-methylpropan-2-yl)oxy]nonanoic acid |
|---|---|
| PubChem CID | 87962949 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 4,4-bis[(2-methylpropan-2-yl)oxy]nonanoic acid |
| SMILES | CCCCCC(CCC(=O)O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C17H34O4/c1-8-9-10-12-17(13-11-14(18)19,20-15(2,3)4)21-16(5,6)7/h8-13H2,1-7H3,(H,18,19) |
| InChIKey | MCOOXFBUEXPPLI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|