About hexanoic acid;2-methylpropan-2-ol
hexanoic acid;2-methylpropan-2-ol (PubChem CID 161308342) has the molecular formula C10H22O3
and a molecular weight of 190.28 g/mol. Its IUPAC name is hexanoic acid;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | hexanoic acid;2-methylpropan-2-ol |
| PubChem CID | 161308342 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | hexanoic acid;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CCCCCC(=O)O |
| InChI | InChI=1S/C6H12O2.C4H10O/c1-2-3-4-5-6(7)8;1-4(2,3)5/h2-5H2,1H3,(H,7,8);5H,1-3H3 |
| InChIKey | VIODNXNRZMMYKS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoic acid;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoic acid;2-methylpropan-2-ol?
The IUPAC name of hexanoic acid;2-methylpropan-2-ol (CID 161308342) is hexanoic acid;2-methylpropan-2-ol.
What is the SMILES notation for hexanoic acid;2-methylpropan-2-ol?
The canonical SMILES for hexanoic acid;2-methylpropan-2-ol is CC(C)(C)O.CCCCCC(=O)O.
What is the InChIKey of hexanoic acid;2-methylpropan-2-ol?
The InChIKey is VIODNXNRZMMYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H10O/c1-2-3-4-5-6(7)8;1-4(2,3)5/h2-5H2,1H3,(H,7,8);5H,1-3H3.
What are the key properties of hexanoic acid;2-methylpropan-2-ol?
hexanoic acid;2-methylpropan-2-ol has a molecular weight of 190.28 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoic acid;2-methylpropan-2-ol is sourced from PubChem (CID 161308342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).