C10H12F2NO5P — CID 87963950
(2R)-2-fluoro-2-[fluoro-[hydroxy(methoxy)phosphoryl]amino]-3-phenylpropanoic acid (PubChem CID 87963950) has the molecular formula C10H12F2NO5P and a molecular weight of 295.18 g/mol. Its IUPAC name is (2R)-2-fluoro-2-[fluoro-[hydroxy(methoxy)phosphoryl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-fluoro-2-[fluoro-[hydroxy(methoxy)phosphoryl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 87963950 |
| Molecular Formula | C10H12F2NO5P |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (2R)-2-fluoro-2-[fluoro-[hydroxy(methoxy)phosphoryl]amino]-3-phenylpropanoic acid |
| SMILES | COP(=O)(O)N(F)[C@@](F)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H12F2NO5P/c1-18-19(16,17)13(12)10(11,9(14)15)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | YHUCPCSCWFPLIE-JTQLQIEISA-N |
| XLogP | 1.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|