C13H20NO13P3 — CID 73013324
2,2-bis[hydroxy(methoxy)phosphoryl]-2-[[hydroxy(methoxy)phosphoryl]-phenylmethoxycarbonylamino]acetic acid (PubChem CID 73013324) has the molecular formula C13H20NO13P3 and a molecular weight of 491.22 g/mol. Its IUPAC name is 2,2-bis[hydroxy(methoxy)phosphoryl]-2-[[hydroxy(methoxy)phosphoryl]-phenylmethoxycarbonylamino]acetic acid.
| Compound Name | 2,2-bis[hydroxy(methoxy)phosphoryl]-2-[[hydroxy(methoxy)phosphoryl]-phenylmethoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 73013324 |
| Molecular Formula | C13H20NO13P3 |
| Molecular Weight | 491.22 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 2,2-bis[hydroxy(methoxy)phosphoryl]-2-[[hydroxy(methoxy)phosphoryl]-phenylmethoxycarbonylamino]acetic acid |
| SMILES | COP(=O)(O)N(C(=O)OCc1ccccc1)C(C(=O)O)(P(=O)(O)OC)P(=O)(O)OC |
| InChI | InChI=1S/C13H20NO13P3/c1-24-28(18,19)13(11(15)16,29(20,21)25-2)14(30(22,23)26-3)12(17)27-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,15,16)(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | GWWUKXUPIGIIKS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 206.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|