C14H14O — CID 87964052
2,4,4a,4b-tetrahydro-1H-phenanthren-3-one (PubChem CID 87964052) has the molecular formula C14H14O and a molecular weight of 198.27 g/mol. Its IUPAC name is 2,4,4a,4b-tetrahydro-1H-phenanthren-3-one.
| Compound Name | 2,4,4a,4b-tetrahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 87964052 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2,4,4a,4b-tetrahydro-1H-phenanthren-3-one |
| SMILES | O=C1CCC2=CC=C3C=CC=CC3C2C1 |
| InChI | InChI=1S/C14H14O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-6,13-14H,7-9H2 |
| InChIKey | LMILZGCEZBPVSI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |