C14H16N2O6S2 — CID 87966678
4-[1,2-diamino-1-(4-sulfophenyl)ethyl]benzenesulfonic acid (PubChem CID 87966678) has the molecular formula C14H16N2O6S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[1,2-diamino-1-(4-sulfophenyl)ethyl]benzenesulfonic acid.
| Compound Name | 4-[1,2-diamino-1-(4-sulfophenyl)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87966678 |
| Molecular Formula | C14H16N2O6S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-[1,2-diamino-1-(4-sulfophenyl)ethyl]benzenesulfonic acid |
| SMILES | NCC(N)(c1ccc(S(=O)(=O)O)cc1)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H16N2O6S2/c15-9-14(16,10-1-5-12(6-2-10)23(17,18)19)11-3-7-13(8-4-11)24(20,21)22/h1-8H,9,15-16H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | VRQIDDVPYRYECK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|