About O-(1-aminopropan-2-yl) hexadecanethioate
O-(1-aminopropan-2-yl) hexadecanethioate (PubChem CID 87966960) has the molecular formula C19H39NOS
and a molecular weight of 329.59 g/mol. Its IUPAC name is O-(1-aminopropan-2-yl) hexadecanethioate.
Molecular Properties
| Compound Name | O-(1-aminopropan-2-yl) hexadecanethioate |
| PubChem CID | 87966960 |
| Molecular Formula | C19H39NOS |
| Molecular Weight | 329.59 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | O-(1-aminopropan-2-yl) hexadecanethioate |
| SMILES | CCCCCCCCCCCCCCCC(=S)OC(C)CN |
| InChI | InChI=1S/C19H39NOS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(22)21-18(2)17-20/h18H,3-17,20H2,1-2H3 |
| InChIKey | NDMVANRIMKDJBK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(1-aminopropan-2-yl) hexadecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1-aminopropan-2-yl) hexadecanethioate?
The IUPAC name of O-(1-aminopropan-2-yl) hexadecanethioate (CID 87966960) is O-(1-aminopropan-2-yl) hexadecanethioate.
What is the SMILES notation for O-(1-aminopropan-2-yl) hexadecanethioate?
The canonical SMILES for O-(1-aminopropan-2-yl) hexadecanethioate is CCCCCCCCCCCCCCCC(=S)OC(C)CN.
What is the InChIKey of O-(1-aminopropan-2-yl) hexadecanethioate?
The InChIKey is NDMVANRIMKDJBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NOS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(22)21-18(2)17-20/h18H,3-17,20H2,1-2H3.
What are the key properties of O-(1-aminopropan-2-yl) hexadecanethioate?
O-(1-aminopropan-2-yl) hexadecanethioate has a molecular weight of 329.59 g/mol, XLogP of 6.16, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1-aminopropan-2-yl) hexadecanethioate is sourced from PubChem (CID 87966960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).