C6H6Br8 — CID 87967476
1,1,1,2,2,3,3,4-octabromohexane (PubChem CID 87967476) has the molecular formula C6H6Br8 and a molecular weight of 717.35 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4-octabromohexane.
| Compound Name | 1,1,1,2,2,3,3,4-octabromohexane |
|---|---|
| PubChem CID | 87967476 |
| Molecular Formula | C6H6Br8 |
| Molecular Weight | 717.35 g/mol |
| Exact Mass | 709.39 |
| IUPAC Name | 1,1,1,2,2,3,3,4-octabromohexane |
| SMILES | CCC(Br)C(Br)(Br)C(Br)(Br)C(Br)(Br)Br |
| InChI | InChI=1S/C6H6Br8/c1-2-3(7)4(8,9)5(10,11)6(12,13)14/h3H,2H2,1H3 |
| InChIKey | MASLMKXQXKRPPB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.35 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|