C18H15O27PS9 — CID 87967600
4-bis(2,3,4-trisulfophenyl)phosphanylbenzene-1,2,3-trisulfonic acid (PubChem CID 87967600) has the molecular formula C18H15O27PS9 and a molecular weight of 982.87 g/mol. Its IUPAC name is 4-bis(2,3,4-trisulfophenyl)phosphanylbenzene-1,2,3-trisulfonic acid.
| Compound Name | 4-bis(2,3,4-trisulfophenyl)phosphanylbenzene-1,2,3-trisulfonic acid |
|---|---|
| PubChem CID | 87967600 |
| Molecular Formula | C18H15O27PS9 |
| Molecular Weight | 982.87 g/mol |
| Exact Mass | 981.70 |
| IUPAC Name | 4-bis(2,3,4-trisulfophenyl)phosphanylbenzene-1,2,3-trisulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(P(c2ccc(S(=O)(=O)O)c(S(=O)(=O)O)c2S(=O)(=O)O)c2ccc(S(=O)(=O)O)c(S(=O)(=O)O)c2S(=O)(=O)O)c(S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C18H15O27PS9/c19-47(20,21)10-4-1-7(13(50(28,29)30)16(10)53(37,38)39)46(8-2-5-11(48(22,23)24)17(54(40,41)42)14(8)51(31,32)33)9-3-6-12(49(25,26)27)18(55(43,44)45)15(9)52(34,35)36/h1-6H,(H,19,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30)(H,31,32,33)(H,34,35,36)(H,37,38,39)(H,40,41,42)(H,43,44,45) |
| InChIKey | ZQOALHPXIKTRNX-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 489.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.87 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|