C20H15N3OS — CID 8796764
5-(2-benzylsulfanylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 8796764) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 5-(2-benzylsulfanylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2-benzylsulfanylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 8796764 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 5-(2-benzylsulfanylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(CSc2ccccc2-c2nc(-c3ccncc3)no2)cc1 |
| InChI | InChI=1S/C20H15N3OS/c1-2-6-15(7-3-1)14-25-18-9-5-4-8-17(18)20-22-19(23-24-20)16-10-12-21-13-11-16/h1-13H,14H2 |
| InChIKey | OAAIBKZRQLTYKG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |