C25H29FN2O3 — CID 87969714
[(3S,6R)-1-[(4-fluorophenyl)methyl]-4-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxymethyl]-3,6-dimethylpiperazin-2-ylidene]methanone (PubChem CID 87969714) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is [(3S,6R)-1-[(4-fluorophenyl)methyl]-4-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxymethyl]-3,6-dimethylpiperazin-2-ylidene]methanone.
| Compound Name | [(3S,6R)-1-[(4-fluorophenyl)methyl]-4-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxymethyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
|---|---|
| PubChem CID | 87969714 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [(3S,6R)-1-[(4-fluorophenyl)methyl]-4-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxymethyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
| SMILES | C[C@@H]1CN(COc2cccc3c2CCCC3O)[C@@H](C)C(=C=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN2O3/c1-17-13-27(16-31-25-8-4-5-21-22(25)6-3-7-24(21)30)18(2)23(15-29)28(17)14-19-9-11-20(26)12-10-19/h4-5,8-12,17-18,24,30H,3,6-7,13-14,16H2,1-2H3/t17-,18+,24?/m1/s1 |
| InChIKey | NOHYOEAJDGGDJH-IHHKOXMGSA-N |
| XLogP | 3.84 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|