C23H24FN3O5S2 — CID 87970654
(2S)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-hydroxyamino]-3-methyl-3-(pyridin-2-ylmethylsulfanyl)butanamide (PubChem CID 87970654) has the molecular formula C23H24FN3O5S2 and a molecular weight of 505.59 g/mol. Its IUPAC name is (2S)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-hydroxyamino]-3-methyl-3-(pyridin-2-ylmethylsulfanyl)butanamide.
| Compound Name | (2S)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-hydroxyamino]-3-methyl-3-(pyridin-2-ylmethylsulfanyl)butanamide |
|---|---|
| PubChem CID | 87970654 |
| Molecular Formula | C23H24FN3O5S2 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (2S)-2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-hydroxyamino]-3-methyl-3-(pyridin-2-ylmethylsulfanyl)butanamide |
| SMILES | CC(C)(SCc1ccccn1)[C@H](C(N)=O)N(O)S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H24FN3O5S2/c1-23(2,33-15-17-5-3-4-14-26-17)21(22(25)28)27(29)34(30,31)20-12-10-19(11-13-20)32-18-8-6-16(24)7-9-18/h3-14,21,29H,15H2,1-2H3,(H2,25,28)/t21-/m0/s1 |
| InChIKey | NXYRQZROHBGPAE-NRFANRHFSA-N |
| XLogP | 3.96 |
| TPSA | 122.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|