C20H18FNO4S — CID 141362712
4-[3-(4-fluorophenoxy)phenoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 141362712) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is 4-[3-(4-fluorophenoxy)phenoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[3-(4-fluorophenoxy)phenoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 141362712 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-[3-(4-fluorophenoxy)phenoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Oc2cccc(Oc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C20H18FNO4S/c1-22(2)27(23,24)20-12-10-17(11-13-20)26-19-5-3-4-18(14-19)25-16-8-6-15(21)7-9-16/h3-14H,1-2H3 |
| InChIKey | OBSGYCPWTJEAHU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |