C19H21N3O2S — CID 8797362
N-[2-(cyanomethylsulfanyl)phenyl]-2-[methyl(2-phenoxyethyl)amino]acetamide (PubChem CID 8797362) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[methyl(2-phenoxyethyl)amino]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[methyl(2-phenoxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 8797362 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[methyl(2-phenoxyethyl)amino]acetamide |
| SMILES | CN(CCOc1ccccc1)CC(=O)Nc1ccccc1SCC#N |
| InChI | InChI=1S/C19H21N3O2S/c1-22(12-13-24-16-7-3-2-4-8-16)15-19(23)21-17-9-5-6-10-18(17)25-14-11-20/h2-10H,12-15H2,1H3,(H,21,23) |
| InChIKey | UGKNUMFAZTZFGM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |