C25H30O4 — CID 87977057
2-methylpropyl 2-(methoxymethyl)prop-2-enoate;4-(4-phenylbuta-1,3-dienyl)phenol (PubChem CID 87977057) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-methylpropyl 2-(methoxymethyl)prop-2-enoate;4-(4-phenylbuta-1,3-dienyl)phenol.
| Compound Name | 2-methylpropyl 2-(methoxymethyl)prop-2-enoate;4-(4-phenylbuta-1,3-dienyl)phenol |
|---|---|
| PubChem CID | 87977057 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-methylpropyl 2-(methoxymethyl)prop-2-enoate;4-(4-phenylbuta-1,3-dienyl)phenol |
| SMILES | C=C(COC)C(=O)OCC(C)C.Oc1ccc(C=CC=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O.C9H16O3/c17-16-12-10-15(11-13-16)9-5-4-8-14-6-2-1-3-7-14;1-7(2)5-12-9(10)8(3)6-11-4/h1-13,17H;7H,3,5-6H2,1-2,4H3 |
| InChIKey | UQCSFUIIEOGSKV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|