C31H28ClFN4O4S2 — CID 87980066
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[1-(3-methyl-1-sulfonylbutoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine (PubChem CID 87980066) has the molecular formula C31H28ClFN4O4S2 and a molecular weight of 639.17 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[1-(3-methyl-1-sulfonylbutoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[1-(3-methyl-1-sulfonylbutoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87980066 |
| Molecular Formula | C31H28ClFN4O4S2 |
| Molecular Weight | 639.17 g/mol |
| Exact Mass | 638.12 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[1-(3-methyl-1-sulfonylbutoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine |
| SMILES | CC(C)CC(OC(C)c1nc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)cs1)=S(=O)=O |
| InChI | InChI=1S/C31H28ClFN4O4S2/c1-18(2)11-29(43(38)39)41-19(3)31-37-27(16-42-31)21-7-9-26-24(13-21)30(35-17-34-26)36-23-8-10-28(25(32)14-23)40-15-20-5-4-6-22(33)12-20/h4-10,12-14,16-19H,11,15H2,1-3H3,(H,34,35,36) |
| InChIKey | DAFKICUQXLOMIE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.17 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|