C20H21BrN2O4 — CID 87980417
(E)-1-[4-amino-3-(dimethylamino)phenyl]-2-bromo-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 87980417) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is (E)-1-[4-amino-3-(dimethylamino)phenyl]-2-bromo-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-amino-3-(dimethylamino)phenyl]-2-bromo-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87980417 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (E)-1-[4-amino-3-(dimethylamino)phenyl]-2-bromo-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | COc1c(/C=C(/Br)C(=O)c2ccc(N)c(N(C)C)c2)ccc2c1OCCO2 |
| InChI | InChI=1S/C20H21BrN2O4/c1-23(2)16-11-12(4-6-15(16)22)18(24)14(21)10-13-5-7-17-20(19(13)25-3)27-9-8-26-17/h4-7,10-11H,8-9,22H2,1-3H3/b14-10+ |
| InChIKey | AJALKEWKNBZNGC-GXDHUFHOSA-N |
| XLogP | 3.73 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|