C27H29ClF6N2O4 — CID 87981530
propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-cyclopropyl-1,2,3,4-tetrahydroquinolin-1-ium-1-carboxylate chloride (PubChem CID 87981530) has the molecular formula C27H29ClF6N2O4 and a molecular weight of 594.98 g/mol. Its IUPAC name is propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-cyclopropyl-1,2,3,4-tetrahydroquinolin-1-ium-1-carboxylate chloride.
| Compound Name | propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-cyclopropyl-1,2,3,4-tetrahydroquinolin-1-ium-1-carboxylate chloride |
|---|---|
| PubChem CID | 87981530 |
| Molecular Formula | C27H29ClF6N2O4 |
| Molecular Weight | 594.98 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-cyclopropyl-1,2,3,4-tetrahydroquinolin-1-ium-1-carboxylate chloride |
| SMILES | COC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1C[C@@H](C2CC2)[NH+](C(=O)OC(C)C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C27H28F6N2O4.ClH/c1-15(2)39-25(37)35-21-7-5-4-6-20(21)23(13-22(35)17-8-9-17)34(24(36)38-3)14-16-10-18(26(28,29)30)12-19(11-16)27(31,32)33;/h4-7,10-12,15,17,22-23H,8-9,13-14H2,1-3H3;1H/t22-,23-;/m0./s1 |
| InChIKey | HOSYKZIXIVCUAS-SJEIDVEUSA-N |
| XLogP | 3.28 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.98 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |