C27H36N4O3 — CID 87982328
N-[2-[3-[4-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl]propyl-methylamino]ethyl]-1H-indole-2-carboxamide (PubChem CID 87982328) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[2-[3-[4-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl]propyl-methylamino]ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[3-[4-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl]propyl-methylamino]ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 87982328 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[2-[3-[4-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]phenyl]propyl-methylamino]ethyl]-1H-indole-2-carboxamide |
| SMILES | CN(CCCc1ccc(CN(C=O)OC(C)(C)C)cc1)CCNC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H36N4O3/c1-27(2,3)34-31(20-32)19-22-13-11-21(12-14-22)8-7-16-30(4)17-15-28-26(33)25-18-23-9-5-6-10-24(23)29-25/h5-6,9-14,18,20,29H,7-8,15-17,19H2,1-4H3,(H,28,33) |
| InChIKey | JGQFQNNLIAWRSR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|