C16H13N3O3 — CID 879865
1-benzyl-6-hydroxy-5-(pyrrol-2-ylidenemethyl)pyrimidine-2,4-dione (PubChem CID 879865) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-5-(pyrrol-2-ylidenemethyl)pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-hydroxy-5-(pyrrol-2-ylidenemethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 879865 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-benzyl-6-hydroxy-5-(pyrrol-2-ylidenemethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c(O)c1C=C1C=CC=N1 |
| InChI | InChI=1S/C16H13N3O3/c20-14-13(9-12-7-4-8-17-12)15(21)19(16(22)18-14)10-11-5-2-1-3-6-11/h1-9,21H,10H2,(H,18,20,22) |
| InChIKey | YJZYLBKLHJPAFL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |