C22H48N2 — CID 87986507
1-N',1-N'-dimethyl-1-N-octadecylethane-1,1-diamine (PubChem CID 87986507) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is 1-N',1-N'-dimethyl-1-N-octadecylethane-1,1-diamine.
| Compound Name | 1-N',1-N'-dimethyl-1-N-octadecylethane-1,1-diamine |
|---|---|
| PubChem CID | 87986507 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | 1-N',1-N'-dimethyl-1-N-octadecylethane-1,1-diamine |
| SMILES | CCCCCCCCCCCCCCCCCCNC(C)N(C)C |
| InChI | InChI=1S/C22H48N2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-22(2)24(3)4/h22-23H,5-21H2,1-4H3 |
| InChIKey | NMABFSDVTMOFRN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|