C13H15NO — CID 87990529
1,2,3,4,4a,5-hexahydrophenanthridin-3-ol (PubChem CID 87990529) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-3-ol.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-3-ol |
|---|---|
| PubChem CID | 87990529 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-3-ol |
| SMILES | OC1CCC2=c3ccccc3=CNC2C1 |
| InChI | InChI=1S/C13H15NO/c15-10-5-6-12-11-4-2-1-3-9(11)8-14-13(12)7-10/h1-4,8,10,13-15H,5-7H2 |
| InChIKey | YNMWUUNIWJZGET-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |