C13H16BrNO — CID 87498020
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;hydrobromide (PubChem CID 87498020) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;hydrobromide.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;hydrobromide |
|---|---|
| PubChem CID | 87498020 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;hydrobromide |
| SMILES | Br.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.BrH/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;/h1-4,8,10,13-15H,5-7H2;1H |
| InChIKey | OCYJJQHAOMADKX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |