C13H17NO5S — CID 87539292
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;sulfuric acid (PubChem CID 87539292) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;sulfuric acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;sulfuric acid |
|---|---|
| PubChem CID | 87539292 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;sulfuric acid |
| SMILES | O=S(=O)(O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.H2O4S/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;1-5(2,3)4/h1-4,8,10,13-15H,5-7H2;(H2,1,2,3,4) |
| InChIKey | VLLGWUISZLZYAA-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|