C14H19NO4S — CID 87539330
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;methanesulfonic acid (PubChem CID 87539330) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;methanesulfonic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 87539330 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.CH4O3S/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;1-5(2,3)4/h1-4,8,10,13-15H,5-7H2;1H3,(H,2,3,4) |
| InChIKey | FOLZCDZGFGBGTF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|